C12H14Cl2N2O4 — CID 59667733
2,2-dichloro-N-[(1S,2R)-1-hydroxy-1-(4-nitrophenyl)butan-2-yl]acetamide (PubChem CID 59667733) has the molecular formula C12H14Cl2N2O4 and a molecular weight of 321.16 g/mol. Its IUPAC name is 2,2-dichloro-N-[(1S,2R)-1-hydroxy-1-(4-nitrophenyl)butan-2-yl]acetamide.
| Compound Name | 2,2-dichloro-N-[(1S,2R)-1-hydroxy-1-(4-nitrophenyl)butan-2-yl]acetamide |
|---|---|
| PubChem CID | 59667733 |
| Molecular Formula | C12H14Cl2N2O4 |
| Molecular Weight | 321.16 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | 2,2-dichloro-N-[(1S,2R)-1-hydroxy-1-(4-nitrophenyl)butan-2-yl]acetamide |
| SMILES | CC[C@@H](NC(=O)C(Cl)Cl)[C@@H](O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C12H14Cl2N2O4/c1-2-9(15-12(18)11(13)14)10(17)7-3-5-8(6-4-7)16(19)20/h3-6,9-11,17H,2H2,1H3,(H,15,18)/t9-,10+/m1/s1 |
| InChIKey | QYUQNGHCUMWWDB-ZJUUUORDSA-N |
| XLogP | 2.33 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.16 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|