C20H20Cl2N2O6 — CID 165340458
[(2R,3R)-2-[(2,2-dichloroacetyl)amino]-3-hydroxy-3-(4-nitrophenyl)propyl] (2S)-2-phenylpropanoate (PubChem CID 165340458) has the molecular formula C20H20Cl2N2O6 and a molecular weight of 455.29 g/mol. Its IUPAC name is [(2R,3R)-2-[(2,2-dichloroacetyl)amino]-3-hydroxy-3-(4-nitrophenyl)propyl] (2S)-2-phenylpropanoate.
| Compound Name | [(2R,3R)-2-[(2,2-dichloroacetyl)amino]-3-hydroxy-3-(4-nitrophenyl)propyl] (2S)-2-phenylpropanoate |
|---|---|
| PubChem CID | 165340458 |
| Molecular Formula | C20H20Cl2N2O6 |
| Molecular Weight | 455.29 g/mol |
| Exact Mass | 454.07 |
| IUPAC Name | [(2R,3R)-2-[(2,2-dichloroacetyl)amino]-3-hydroxy-3-(4-nitrophenyl)propyl] (2S)-2-phenylpropanoate |
| SMILES | C[C@H](C(=O)OC[C@@H](NC(=O)C(Cl)Cl)[C@H](O)c1ccc([N+](=O)[O-])cc1)c1ccccc1 |
| InChI | InChI=1S/C20H20Cl2N2O6/c1-12(13-5-3-2-4-6-13)20(27)30-11-16(23-19(26)18(21)22)17(25)14-7-9-15(10-8-14)24(28)29/h2-10,12,16-18,25H,11H2,1H3,(H,23,26)/t12-,16+,17+/m0/s1 |
| InChIKey | YEPKAAAAVSHBIB-JCURWCKSSA-N |
| XLogP | 3.26 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.29 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|