C16H14Cl2N4O6 — CID 168664925
[2-[(2,2-dichloroacetyl)amino]-3-hydroxy-3-(4-nitrophenyl)propyl] pyrazine-2-carboxylate (PubChem CID 168664925) has the molecular formula C16H14Cl2N4O6 and a molecular weight of 429.22 g/mol. Its IUPAC name is [2-[(2,2-dichloroacetyl)amino]-3-hydroxy-3-(4-nitrophenyl)propyl] pyrazine-2-carboxylate.
| Compound Name | [2-[(2,2-dichloroacetyl)amino]-3-hydroxy-3-(4-nitrophenyl)propyl] pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 168664925 |
| Molecular Formula | C16H14Cl2N4O6 |
| Molecular Weight | 429.22 g/mol |
| Exact Mass | 428.03 |
| IUPAC Name | [2-[(2,2-dichloroacetyl)amino]-3-hydroxy-3-(4-nitrophenyl)propyl] pyrazine-2-carboxylate |
| SMILES | O=C(OCC(NC(=O)C(Cl)Cl)C(O)c1ccc([N+](=O)[O-])cc1)c1cnccn1 |
| InChI | InChI=1S/C16H14Cl2N4O6/c17-14(18)15(24)21-12(8-28-16(25)11-7-19-5-6-20-11)13(23)9-1-3-10(4-2-9)22(26)27/h1-7,12-14,23H,8H2,(H,21,24) |
| InChIKey | YBIAGWWKQKHOPF-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 144.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.22 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|