C17H24Cl2N4O6 — CID 67362672
[(2R,3R)-2-[(2,2-dichloroacetyl)amino]-3-hydroxy-3-(4-nitrophenyl)propyl] (2S)-2,6-diaminohexanoate (PubChem CID 67362672) has the molecular formula C17H24Cl2N4O6 and a molecular weight of 451.31 g/mol. Its IUPAC name is [(2R,3R)-2-[(2,2-dichloroacetyl)amino]-3-hydroxy-3-(4-nitrophenyl)propyl] (2S)-2,6-diaminohexanoate.
| Compound Name | [(2R,3R)-2-[(2,2-dichloroacetyl)amino]-3-hydroxy-3-(4-nitrophenyl)propyl] (2S)-2,6-diaminohexanoate |
|---|---|
| PubChem CID | 67362672 |
| Molecular Formula | C17H24Cl2N4O6 |
| Molecular Weight | 451.31 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | [(2R,3R)-2-[(2,2-dichloroacetyl)amino]-3-hydroxy-3-(4-nitrophenyl)propyl] (2S)-2,6-diaminohexanoate |
| SMILES | NCCCC[C@H](N)C(=O)OC[C@@H](NC(=O)C(Cl)Cl)[C@H](O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H24Cl2N4O6/c18-15(19)16(25)22-13(9-29-17(26)12(21)3-1-2-8-20)14(24)10-4-6-11(7-5-10)23(27)28/h4-7,12-15,24H,1-3,8-9,20-21H2,(H,22,25)/t12-,13+,14+/m0/s1 |
| InChIKey | URDRKSHXXYTSCY-BFHYXJOUSA-N |
| XLogP | 0.92 |
| TPSA | 170.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.31 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|