C14H20Cl2N2O5Si — CID 552461
2,2-dichloro-N-[1-hydroxy-1-(4-nitrophenyl)-3-trimethylsilyloxypropan-2-yl]acetamide (PubChem CID 552461) has the molecular formula C14H20Cl2N2O5Si and a molecular weight of 395.32 g/mol. Its IUPAC name is 2,2-dichloro-N-[1-hydroxy-1-(4-nitrophenyl)-3-trimethylsilyloxypropan-2-yl]acetamide.
| Compound Name | 2,2-dichloro-N-[1-hydroxy-1-(4-nitrophenyl)-3-trimethylsilyloxypropan-2-yl]acetamide |
|---|---|
| PubChem CID | 552461 |
| Molecular Formula | C14H20Cl2N2O5Si |
| Molecular Weight | 395.32 g/mol |
| Exact Mass | 394.05 |
| IUPAC Name | 2,2-dichloro-N-[1-hydroxy-1-(4-nitrophenyl)-3-trimethylsilyloxypropan-2-yl]acetamide |
| SMILES | C[Si](C)(C)OCC(NC(=O)C(Cl)Cl)C(O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H20Cl2N2O5Si/c1-24(2,3)23-8-11(17-14(20)13(15)16)12(19)9-4-6-10(7-5-9)18(21)22/h4-7,11-13,19H,8H2,1-3H3,(H,17,20) |
| InChIKey | UUZVFLYOJDPARU-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.32 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|