C18H28Cl2N2O4Si — CID 160664255
N-[(2S,3S)-1-[tert-butyl(dimethyl)silyl]oxy-3-(4-nitrophenyl)butan-2-yl]-2,2-dichloroacetamide (PubChem CID 160664255) has the molecular formula C18H28Cl2N2O4Si and a molecular weight of 435.42 g/mol. Its IUPAC name is N-[(2S,3S)-1-[tert-butyl(dimethyl)silyl]oxy-3-(4-nitrophenyl)butan-2-yl]-2,2-dichloroacetamide.
| Compound Name | N-[(2S,3S)-1-[tert-butyl(dimethyl)silyl]oxy-3-(4-nitrophenyl)butan-2-yl]-2,2-dichloroacetamide |
|---|---|
| PubChem CID | 160664255 |
| Molecular Formula | C18H28Cl2N2O4Si |
| Molecular Weight | 435.42 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | N-[(2S,3S)-1-[tert-butyl(dimethyl)silyl]oxy-3-(4-nitrophenyl)butan-2-yl]-2,2-dichloroacetamide |
| SMILES | C[C@@H](c1ccc([N+](=O)[O-])cc1)[C@@H](CO[Si](C)(C)C(C)(C)C)NC(=O)C(Cl)Cl |
| InChI | InChI=1S/C18H28Cl2N2O4Si/c1-12(13-7-9-14(10-8-13)22(24)25)15(21-17(23)16(19)20)11-26-27(5,6)18(2,3)4/h7-10,12,15-16H,11H2,1-6H3,(H,21,23)/t12-,15+/m0/s1 |
| InChIKey | RMBRZCNVEQXGJP-SWLSCSKDSA-N |
| XLogP | 5.01 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.42 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|