C22H39NO6Si2 — CID 24862194
(3R,4S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-4-hydroxy-4-(4-nitrophenyl)butan-2-one (PubChem CID 24862194) has the molecular formula C22H39NO6Si2 and a molecular weight of 469.73 g/mol. Its IUPAC name is (3R,4S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-4-hydroxy-4-(4-nitrophenyl)butan-2-one.
| Compound Name | (3R,4S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-4-hydroxy-4-(4-nitrophenyl)butan-2-one |
|---|---|
| PubChem CID | 24862194 |
| Molecular Formula | C22H39NO6Si2 |
| Molecular Weight | 469.73 g/mol |
| Exact Mass | 469.23 |
| IUPAC Name | (3R,4S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-4-hydroxy-4-(4-nitrophenyl)butan-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OCC(=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H39NO6Si2/c1-21(2,3)30(7,8)28-15-18(24)20(29-31(9,10)22(4,5)6)19(25)16-11-13-17(14-12-16)23(26)27/h11-14,19-20,25H,15H2,1-10H3/t19-,20-/m0/s1 |
| InChIKey | QXICTQUPIDHXOR-PMACEKPBSA-N |
| XLogP | 5.61 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.73 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|