C17H25NO5Si — CID 11739619
methyl 2-[[tert-butyl(dimethyl)silyl]oxy-(4-nitrophenyl)methyl]prop-2-enoate (PubChem CID 11739619) has the molecular formula C17H25NO5Si and a molecular weight of 351.48 g/mol. Its IUPAC name is methyl 2-[[tert-butyl(dimethyl)silyl]oxy-(4-nitrophenyl)methyl]prop-2-enoate.
| Compound Name | methyl 2-[[tert-butyl(dimethyl)silyl]oxy-(4-nitrophenyl)methyl]prop-2-enoate |
|---|---|
| PubChem CID | 11739619 |
| Molecular Formula | C17H25NO5Si |
| Molecular Weight | 351.48 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | methyl 2-[[tert-butyl(dimethyl)silyl]oxy-(4-nitrophenyl)methyl]prop-2-enoate |
| SMILES | C=C(C(=O)OC)C(O[Si](C)(C)C(C)(C)C)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H25NO5Si/c1-12(16(19)22-5)15(23-24(6,7)17(2,3)4)13-8-10-14(11-9-13)18(20)21/h8-11,15H,1H2,2-7H3 |
| InChIKey | WKKZJSGFBDNUOU-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.48 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|