C17H26O2Si — CID 102483532
3-[[tert-butyl(dimethyl)silyl]oxy-phenylmethyl]but-3-en-2-one (PubChem CID 102483532) has the molecular formula C17H26O2Si and a molecular weight of 290.48 g/mol. Its IUPAC name is 3-[[tert-butyl(dimethyl)silyl]oxy-phenylmethyl]but-3-en-2-one.
| Compound Name | 3-[[tert-butyl(dimethyl)silyl]oxy-phenylmethyl]but-3-en-2-one |
|---|---|
| PubChem CID | 102483532 |
| Molecular Formula | C17H26O2Si |
| Molecular Weight | 290.48 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 3-[[tert-butyl(dimethyl)silyl]oxy-phenylmethyl]but-3-en-2-one |
| SMILES | C=C(C(C)=O)C(O[Si](C)(C)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C17H26O2Si/c1-13(14(2)18)16(15-11-9-8-10-12-15)19-20(6,7)17(3,4)5/h8-12,16H,1H2,2-7H3 |
| InChIKey | DKOBWLBCYCWIBN-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.48 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|