C21H28O2SSi — CID 138977697
1-[tert-butyl(dimethyl)silyl]oxy-1-phenyl-3-phenylsulfanylpropan-2-one (PubChem CID 138977697) has the molecular formula C21H28O2SSi and a molecular weight of 372.61 g/mol. Its IUPAC name is 1-[tert-butyl(dimethyl)silyl]oxy-1-phenyl-3-phenylsulfanylpropan-2-one.
| Compound Name | 1-[tert-butyl(dimethyl)silyl]oxy-1-phenyl-3-phenylsulfanylpropan-2-one |
|---|---|
| PubChem CID | 138977697 |
| Molecular Formula | C21H28O2SSi |
| Molecular Weight | 372.61 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 1-[tert-butyl(dimethyl)silyl]oxy-1-phenyl-3-phenylsulfanylpropan-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OC(C(=O)CSc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H28O2SSi/c1-21(2,3)25(4,5)23-20(17-12-8-6-9-13-17)19(22)16-24-18-14-10-7-11-15-18/h6-15,20H,16H2,1-5H3 |
| InChIKey | DACQSCXVFDGEKZ-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.61 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|