C16H26O3SSi — CID 11674267
methyl 2-[tert-butyl(dimethyl)silyl]oxy-3-phenylsulfanylpropanoate (PubChem CID 11674267) has the molecular formula C16H26O3SSi and a molecular weight of 326.53 g/mol. Its IUPAC name is methyl 2-[tert-butyl(dimethyl)silyl]oxy-3-phenylsulfanylpropanoate.
| Compound Name | methyl 2-[tert-butyl(dimethyl)silyl]oxy-3-phenylsulfanylpropanoate |
|---|---|
| PubChem CID | 11674267 |
| Molecular Formula | C16H26O3SSi |
| Molecular Weight | 326.53 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | methyl 2-[tert-butyl(dimethyl)silyl]oxy-3-phenylsulfanylpropanoate |
| SMILES | COC(=O)C(CSc1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H26O3SSi/c1-16(2,3)21(5,6)19-14(15(17)18-4)12-20-13-10-8-7-9-11-13/h7-11,14H,12H2,1-6H3 |
| InChIKey | FPGINVWNXSCAIL-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.53 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|