C20H35NO3Si — CID 10248295
methyl (2R,3R)-2-[(benzylamino)methyl]-3-[tert-butyl(dimethyl)silyl]oxypentanoate (PubChem CID 10248295) has the molecular formula C20H35NO3Si and a molecular weight of 365.59 g/mol. Its IUPAC name is methyl (2R,3R)-2-[(benzylamino)methyl]-3-[tert-butyl(dimethyl)silyl]oxypentanoate.
| Compound Name | methyl (2R,3R)-2-[(benzylamino)methyl]-3-[tert-butyl(dimethyl)silyl]oxypentanoate |
|---|---|
| PubChem CID | 10248295 |
| Molecular Formula | C20H35NO3Si |
| Molecular Weight | 365.59 g/mol |
| Exact Mass | 365.24 |
| IUPAC Name | methyl (2R,3R)-2-[(benzylamino)methyl]-3-[tert-butyl(dimethyl)silyl]oxypentanoate |
| SMILES | CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](CNCc1ccccc1)C(=O)OC |
| InChI | InChI=1S/C20H35NO3Si/c1-8-18(24-25(6,7)20(2,3)4)17(19(22)23-5)15-21-14-16-12-10-9-11-13-16/h9-13,17-18,21H,8,14-15H2,1-7H3/t17-,18-/m1/s1 |
| InChIKey | DGDGAMHGTCHJSP-QZTJIDSGSA-N |
| XLogP | 4.37 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.59 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|