C18H21NO3 — CID 10086111
methyl (2S,3S)-2-[(benzylamino)methyl]-3-hydroxy-3-phenylpropanoate (PubChem CID 10086111) has the molecular formula C18H21NO3 and a molecular weight of 299.37 g/mol. Its IUPAC name is methyl (2S,3S)-2-[(benzylamino)methyl]-3-hydroxy-3-phenylpropanoate.
| Compound Name | methyl (2S,3S)-2-[(benzylamino)methyl]-3-hydroxy-3-phenylpropanoate |
|---|---|
| PubChem CID | 10086111 |
| Molecular Formula | C18H21NO3 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | methyl (2S,3S)-2-[(benzylamino)methyl]-3-hydroxy-3-phenylpropanoate |
| SMILES | COC(=O)[C@@H](CNCc1ccccc1)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C18H21NO3/c1-22-18(21)16(17(20)15-10-6-3-7-11-15)13-19-12-14-8-4-2-5-9-14/h2-11,16-17,19-20H,12-13H2,1H3/t16-,17+/m0/s1 |
| InChIKey | GRLGQSCFDRCFOG-DLBZAZTESA-N |
| XLogP | 2.30 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |