C15H23O6P — CID 101491715
methyl (2S,3S)-2-(diethoxyphosphorylmethyl)-3-hydroxy-3-phenylpropanoate (PubChem CID 101491715) has the molecular formula C15H23O6P and a molecular weight of 330.32 g/mol. Its IUPAC name is methyl (2S,3S)-2-(diethoxyphosphorylmethyl)-3-hydroxy-3-phenylpropanoate.
| Compound Name | methyl (2S,3S)-2-(diethoxyphosphorylmethyl)-3-hydroxy-3-phenylpropanoate |
|---|---|
| PubChem CID | 101491715 |
| Molecular Formula | C15H23O6P |
| Molecular Weight | 330.32 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | methyl (2S,3S)-2-(diethoxyphosphorylmethyl)-3-hydroxy-3-phenylpropanoate |
| SMILES | CCOP(=O)(C[C@H](C(=O)OC)[C@H](O)c1ccccc1)OCC |
| InChI | InChI=1S/C15H23O6P/c1-4-20-22(18,21-5-2)11-13(15(17)19-3)14(16)12-9-7-6-8-10-12/h6-10,13-14,16H,4-5,11H2,1-3H3/t13-,14+/m0/s1 |
| InChIKey | RJGDWECHSRXAQR-UONOGXRCSA-N |
| XLogP | 2.78 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.32 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|