C26H42N2O6P2 — CID 58650642
(2S)-N,N'-bis(2-diethoxyphosphorylethyl)-1,2-diphenylethane-1,2-diamine (PubChem CID 58650642) has the molecular formula C26H42N2O6P2 and a molecular weight of 540.58 g/mol. Its IUPAC name is (2S)-N,N'-bis(2-diethoxyphosphorylethyl)-1,2-diphenylethane-1,2-diamine.
| Compound Name | (2S)-N,N'-bis(2-diethoxyphosphorylethyl)-1,2-diphenylethane-1,2-diamine |
|---|---|
| PubChem CID | 58650642 |
| Molecular Formula | C26H42N2O6P2 |
| Molecular Weight | 540.58 g/mol |
| Exact Mass | 540.25 |
| IUPAC Name | (2S)-N,N'-bis(2-diethoxyphosphorylethyl)-1,2-diphenylethane-1,2-diamine |
| SMILES | CCOP(=O)(CCNC(c1ccccc1)[C@@H](NCCP(=O)(OCC)OCC)c1ccccc1)OCC |
| InChI | InChI=1S/C26H42N2O6P2/c1-5-31-35(29,32-6-2)21-19-27-25(23-15-11-9-12-16-23)26(24-17-13-10-14-18-24)28-20-22-36(30,33-7-3)34-8-4/h9-18,25-28H,5-8,19-22H2,1-4H3/t25-,26?/m0/s1 |
| InChIKey | LSUUFQXSCZRKSO-PMCHYTPCSA-N |
| XLogP | 6.18 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.58 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|