C22H32N2 — CID 100914664
(1R,2R)-N,N'-dibutyl-1,2-diphenylethane-1,2-diamine (PubChem CID 100914664) has the molecular formula C22H32N2 and a molecular weight of 324.51 g/mol. Its IUPAC name is (1R,2R)-N,N'-dibutyl-1,2-diphenylethane-1,2-diamine.
| Compound Name | (1R,2R)-N,N'-dibutyl-1,2-diphenylethane-1,2-diamine |
|---|---|
| PubChem CID | 100914664 |
| Molecular Formula | C22H32N2 |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.26 |
| IUPAC Name | (1R,2R)-N,N'-dibutyl-1,2-diphenylethane-1,2-diamine |
| SMILES | CCCCN[C@H](c1ccccc1)[C@H](NCCCC)c1ccccc1 |
| InChI | InChI=1S/C22H32N2/c1-3-5-17-23-21(19-13-9-7-10-14-19)22(24-18-6-4-2)20-15-11-8-12-16-20/h7-16,21-24H,3-6,17-18H2,1-2H3/t21-,22-/m1/s1 |
| InChIKey | XVVUNBWSRDKSCV-FGZHOGPDSA-N |
| XLogP | 5.25 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|