C13H21NS — CID 129045615
(1R,2R)-2-(butylamino)-1-phenylpropane-1-thiol (PubChem CID 129045615) has the molecular formula C13H21NS and a molecular weight of 223.39 g/mol. Its IUPAC name is (1R,2R)-2-(butylamino)-1-phenylpropane-1-thiol.
| Compound Name | (1R,2R)-2-(butylamino)-1-phenylpropane-1-thiol |
|---|---|
| PubChem CID | 129045615 |
| Molecular Formula | C13H21NS |
| Molecular Weight | 223.39 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | (1R,2R)-2-(butylamino)-1-phenylpropane-1-thiol |
| SMILES | CCCCN[C@H](C)[C@H](S)c1ccccc1 |
| InChI | InChI=1S/C13H21NS/c1-3-4-10-14-11(2)13(15)12-8-6-5-7-9-12/h5-9,11,13-15H,3-4,10H2,1-2H3/t11-,13+/m1/s1 |
| InChIKey | NAHKAPOPSRMJMB-YPMHNXCESA-N |
| XLogP | 3.44 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.39 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|