C19H26N2 — CID 12964090
N,N'-bis[(1R)-1-phenylethyl]propane-1,3-diamine (PubChem CID 12964090) has the molecular formula C19H26N2 and a molecular weight of 282.43 g/mol. Its IUPAC name is N,N'-bis[(1R)-1-phenylethyl]propane-1,3-diamine.
| Compound Name | N,N'-bis[(1R)-1-phenylethyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 12964090 |
| Molecular Formula | C19H26N2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | N,N'-bis[(1R)-1-phenylethyl]propane-1,3-diamine |
| SMILES | C[C@@H](NCCCN[C@H](C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H26N2/c1-16(18-10-5-3-6-11-18)20-14-9-15-21-17(2)19-12-7-4-8-13-19/h3-8,10-13,16-17,20-21H,9,14-15H2,1-2H3/t16-,17-/m1/s1 |
| InChIKey | SJWAFIWTYFTGRM-IAGOWNOFSA-N |
| XLogP | 4.08 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|