C23H34N2 — CID 101387383
N,N'-bis[(1R)-1-phenylethyl]heptane-1,7-diamine (PubChem CID 101387383) has the molecular formula C23H34N2 and a molecular weight of 338.54 g/mol. Its IUPAC name is N,N'-bis[(1R)-1-phenylethyl]heptane-1,7-diamine.
| Compound Name | N,N'-bis[(1R)-1-phenylethyl]heptane-1,7-diamine |
|---|---|
| PubChem CID | 101387383 |
| Molecular Formula | C23H34N2 |
| Molecular Weight | 338.54 g/mol |
| Exact Mass | 338.27 |
| IUPAC Name | N,N'-bis[(1R)-1-phenylethyl]heptane-1,7-diamine |
| SMILES | C[C@@H](NCCCCCCCN[C@H](C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H34N2/c1-20(22-14-8-6-9-15-22)24-18-12-4-3-5-13-19-25-21(2)23-16-10-7-11-17-23/h6-11,14-17,20-21,24-25H,3-5,12-13,18-19H2,1-2H3/t20-,21-/m1/s1 |
| InChIKey | KNQULSLUJDVDIR-NHCUHLMSSA-N |
| XLogP | 5.64 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.54 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|