C12H17NO2 — CID 63866910
4-[[(1S)-1-phenylethyl]amino]butanoic acid (PubChem CID 63866910) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is 4-[[(1S)-1-phenylethyl]amino]butanoic acid.
| Compound Name | 4-[[(1S)-1-phenylethyl]amino]butanoic acid |
|---|---|
| PubChem CID | 63866910 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 4-[[(1S)-1-phenylethyl]amino]butanoic acid |
| SMILES | C[C@H](NCCCC(=O)O)c1ccccc1 |
| InChI | InChI=1S/C12H17NO2/c1-10(11-6-3-2-4-7-11)13-9-5-8-12(14)15/h2-4,6-7,10,13H,5,8-9H2,1H3,(H,14,15)/t10-/m0/s1 |
| InChIKey | GETSHRLZGBWSHB-JTQLQIEISA-N |
| XLogP | 2.20 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|