C25H38N2O2 — CID 101387384
4,4-dimethoxy-N,N'-bis[(1R)-1-phenylethyl]heptane-1,7-diamine (PubChem CID 101387384) has the molecular formula C25H38N2O2 and a molecular weight of 398.59 g/mol. Its IUPAC name is 4,4-dimethoxy-N,N'-bis[(1R)-1-phenylethyl]heptane-1,7-diamine.
| Compound Name | 4,4-dimethoxy-N,N'-bis[(1R)-1-phenylethyl]heptane-1,7-diamine |
|---|---|
| PubChem CID | 101387384 |
| Molecular Formula | C25H38N2O2 |
| Molecular Weight | 398.59 g/mol |
| Exact Mass | 398.29 |
| IUPAC Name | 4,4-dimethoxy-N,N'-bis[(1R)-1-phenylethyl]heptane-1,7-diamine |
| SMILES | COC(CCCN[C@H](C)c1ccccc1)(CCCN[C@H](C)c1ccccc1)OC |
| InChI | InChI=1S/C25H38N2O2/c1-21(23-13-7-5-8-14-23)26-19-11-17-25(28-3,29-4)18-12-20-27-22(2)24-15-9-6-10-16-24/h5-10,13-16,21-22,26-27H,11-12,17-20H2,1-4H3/t21-,22-/m1/s1 |
| InChIKey | QLYUMOASMVFQOW-FGZHOGPDSA-N |
| XLogP | 5.24 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.59 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|