C12H15BrF3N — CID 115513834
N-[(1R)-1-(3-bromophenyl)ethyl]-4,4,4-trifluorobutan-1-amine (PubChem CID 115513834) has the molecular formula C12H15BrF3N and a molecular weight of 310.16 g/mol. Its IUPAC name is N-[(1R)-1-(3-bromophenyl)ethyl]-4,4,4-trifluorobutan-1-amine.
| Compound Name | N-[(1R)-1-(3-bromophenyl)ethyl]-4,4,4-trifluorobutan-1-amine |
|---|---|
| PubChem CID | 115513834 |
| Molecular Formula | C12H15BrF3N |
| Molecular Weight | 310.16 g/mol |
| Exact Mass | 309.03 |
| IUPAC Name | N-[(1R)-1-(3-bromophenyl)ethyl]-4,4,4-trifluorobutan-1-amine |
| SMILES | C[C@@H](NCCCC(F)(F)F)c1cccc(Br)c1 |
| InChI | InChI=1S/C12H15BrF3N/c1-9(10-4-2-5-11(13)8-10)17-7-3-6-12(14,15)16/h2,4-5,8-9,17H,3,6-7H2,1H3/t9-/m1/s1 |
| InChIKey | RSAVYVUTTPWEBT-SECBINFHSA-N |
| XLogP | 4.44 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.16 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|