C12H16F3NO — CID 113326927
3-[1-(4,4,4-trifluorobutylamino)ethyl]phenol (PubChem CID 113326927) has the molecular formula C12H16F3NO and a molecular weight of 247.26 g/mol. Its IUPAC name is 3-[1-(4,4,4-trifluorobutylamino)ethyl]phenol.
| Compound Name | 3-[1-(4,4,4-trifluorobutylamino)ethyl]phenol |
|---|---|
| PubChem CID | 113326927 |
| Molecular Formula | C12H16F3NO |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 3-[1-(4,4,4-trifluorobutylamino)ethyl]phenol |
| SMILES | CC(NCCCC(F)(F)F)c1cccc(O)c1 |
| InChI | InChI=1S/C12H16F3NO/c1-9(10-4-2-5-11(17)8-10)16-7-3-6-12(13,14)15/h2,4-5,8-9,16-17H,3,6-7H2,1H3 |
| InChIKey | RMLNAWUUMAAEJK-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|