C10H13F2NO — CID 115405831
3-[1-(2,2-difluoroethylamino)ethyl]phenol (PubChem CID 115405831) has the molecular formula C10H13F2NO and a molecular weight of 201.22 g/mol. Its IUPAC name is 3-[1-(2,2-difluoroethylamino)ethyl]phenol.
| Compound Name | 3-[1-(2,2-difluoroethylamino)ethyl]phenol |
|---|---|
| PubChem CID | 115405831 |
| Molecular Formula | C10H13F2NO |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | 3-[1-(2,2-difluoroethylamino)ethyl]phenol |
| SMILES | CC(NCC(F)F)c1cccc(O)c1 |
| InChI | InChI=1S/C10H13F2NO/c1-7(13-6-10(11)12)8-3-2-4-9(14)5-8/h2-5,7,10,13-14H,6H2,1H3 |
| InChIKey | YGTPQHVDUYHLSC-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |