C12H17F2N — CID 115405623
N-[1-(3,4-dimethylphenyl)ethyl]-2,2-difluoroethanamine (PubChem CID 115405623) has the molecular formula C12H17F2N and a molecular weight of 213.27 g/mol. Its IUPAC name is N-[1-(3,4-dimethylphenyl)ethyl]-2,2-difluoroethanamine.
| Compound Name | N-[1-(3,4-dimethylphenyl)ethyl]-2,2-difluoroethanamine |
|---|---|
| PubChem CID | 115405623 |
| Molecular Formula | C12H17F2N |
| Molecular Weight | 213.27 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | N-[1-(3,4-dimethylphenyl)ethyl]-2,2-difluoroethanamine |
| SMILES | Cc1ccc(C(C)NCC(F)F)cc1C |
| InChI | InChI=1S/C12H17F2N/c1-8-4-5-11(6-9(8)2)10(3)15-7-12(13)14/h4-6,10,12,15H,7H2,1-3H3 |
| InChIKey | XSFHYTNTYYRZTF-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.27 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |