C14H23NO2S — CID 103780942
1-(3,4-dimethylphenyl)-N-(2-ethylsulfonylethyl)ethanamine (PubChem CID 103780942) has the molecular formula C14H23NO2S and a molecular weight of 269.41 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-N-(2-ethylsulfonylethyl)ethanamine.
| Compound Name | 1-(3,4-dimethylphenyl)-N-(2-ethylsulfonylethyl)ethanamine |
|---|---|
| PubChem CID | 103780942 |
| Molecular Formula | C14H23NO2S |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-N-(2-ethylsulfonylethyl)ethanamine |
| SMILES | CCS(=O)(=O)CCNC(C)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C14H23NO2S/c1-5-18(16,17)9-8-15-13(4)14-7-6-11(2)12(3)10-14/h6-7,10,13,15H,5,8-9H2,1-4H3 |
| InChIKey | CQEXZDWHUMWVIC-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |