C14H23NOS — CID 115718870
1-(3,4-dimethylphenyl)-N-(2-ethylsulfinylethyl)ethanamine (PubChem CID 115718870) has the molecular formula C14H23NOS and a molecular weight of 253.41 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-N-(2-ethylsulfinylethyl)ethanamine.
| Compound Name | 1-(3,4-dimethylphenyl)-N-(2-ethylsulfinylethyl)ethanamine |
|---|---|
| PubChem CID | 115718870 |
| Molecular Formula | C14H23NOS |
| Molecular Weight | 253.41 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-N-(2-ethylsulfinylethyl)ethanamine |
| SMILES | CCS(=O)CCNC(C)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C14H23NOS/c1-5-17(16)9-8-15-13(4)14-7-6-11(2)12(3)10-14/h6-7,10,13,15H,5,8-9H2,1-4H3 |
| InChIKey | QMXNBHANBRNSHC-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.41 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |