C12H19NO3 — CID 60816650
3-[1-(2,2-dimethoxyethylamino)ethyl]phenol (PubChem CID 60816650) has the molecular formula C12H19NO3 and a molecular weight of 225.29 g/mol. Its IUPAC name is 3-[1-(2,2-dimethoxyethylamino)ethyl]phenol.
| Compound Name | 3-[1-(2,2-dimethoxyethylamino)ethyl]phenol |
|---|---|
| PubChem CID | 60816650 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | 3-[1-(2,2-dimethoxyethylamino)ethyl]phenol |
| SMILES | COC(CNC(C)c1cccc(O)c1)OC |
| InChI | InChI=1S/C12H19NO3/c1-9(13-8-12(15-2)16-3)10-5-4-6-11(14)7-10/h4-7,9,12-14H,8H2,1-3H3 |
| InChIKey | ZLFDHQKTUHQIHV-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|