C15H25NO — CID 83141752
3-[1-(2,3,3-trimethylbutylamino)ethyl]phenol (PubChem CID 83141752) has the molecular formula C15H25NO and a molecular weight of 235.37 g/mol. Its IUPAC name is 3-[1-(2,3,3-trimethylbutylamino)ethyl]phenol.
| Compound Name | 3-[1-(2,3,3-trimethylbutylamino)ethyl]phenol |
|---|---|
| PubChem CID | 83141752 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | 3-[1-(2,3,3-trimethylbutylamino)ethyl]phenol |
| SMILES | CC(NCC(C)C(C)(C)C)c1cccc(O)c1 |
| InChI | InChI=1S/C15H25NO/c1-11(15(3,4)5)10-16-12(2)13-7-6-8-14(17)9-13/h6-9,11-12,16-17H,10H2,1-5H3 |
| InChIKey | HMROQPJUIBOSTR-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |