C12H16F3NO2 — CID 115516399
4-[1-(4,4,4-trifluorobutylamino)ethyl]benzene-1,3-diol (PubChem CID 115516399) has the molecular formula C12H16F3NO2 and a molecular weight of 263.26 g/mol. Its IUPAC name is 4-[1-(4,4,4-trifluorobutylamino)ethyl]benzene-1,3-diol.
| Compound Name | 4-[1-(4,4,4-trifluorobutylamino)ethyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 115516399 |
| Molecular Formula | C12H16F3NO2 |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | 4-[1-(4,4,4-trifluorobutylamino)ethyl]benzene-1,3-diol |
| SMILES | CC(NCCCC(F)(F)F)c1ccc(O)cc1O |
| InChI | InChI=1S/C12H16F3NO2/c1-8(16-6-2-5-12(13,14)15)10-4-3-9(17)7-11(10)18/h3-4,7-8,16-18H,2,5-6H2,1H3 |
| InChIKey | LWGANXDQXIMLLJ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|