C13H20N2O3 — CID 106234212
5-[1-(2,4-dihydroxyphenyl)ethylamino]pentanamide (PubChem CID 106234212) has the molecular formula C13H20N2O3 and a molecular weight of 252.31 g/mol. Its IUPAC name is 5-[1-(2,4-dihydroxyphenyl)ethylamino]pentanamide.
| Compound Name | 5-[1-(2,4-dihydroxyphenyl)ethylamino]pentanamide |
|---|---|
| PubChem CID | 106234212 |
| Molecular Formula | C13H20N2O3 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | 5-[1-(2,4-dihydroxyphenyl)ethylamino]pentanamide |
| SMILES | CC(NCCCCC(N)=O)c1ccc(O)cc1O |
| InChI | InChI=1S/C13H20N2O3/c1-9(15-7-3-2-4-13(14)18)11-6-5-10(16)8-12(11)17/h5-6,8-9,15-17H,2-4,7H2,1H3,(H2,14,18) |
| InChIKey | ZGBFSPYBLYIHFC-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|