C10H15NO3 — CID 43151178
4-[1-(2-hydroxyethylamino)ethyl]benzene-1,3-diol (PubChem CID 43151178) has the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. Its IUPAC name is 4-[1-(2-hydroxyethylamino)ethyl]benzene-1,3-diol.
| Compound Name | 4-[1-(2-hydroxyethylamino)ethyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 43151178 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | 4-[1-(2-hydroxyethylamino)ethyl]benzene-1,3-diol |
| SMILES | CC(NCCO)c1ccc(O)cc1O |
| InChI | InChI=1S/C10H15NO3/c1-7(11-4-5-12)9-3-2-8(13)6-10(9)14/h2-3,6-7,11-14H,4-5H2,1H3 |
| InChIKey | RKRNCGAIBNZQFE-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|