C12H14BrClF3N — CID 82774647
N-[1-(4-bromo-2-chlorophenyl)ethyl]-4,4,4-trifluorobutan-1-amine (PubChem CID 82774647) has the molecular formula C12H14BrClF3N and a molecular weight of 344.60 g/mol. Its IUPAC name is N-[1-(4-bromo-2-chlorophenyl)ethyl]-4,4,4-trifluorobutan-1-amine.
| Compound Name | N-[1-(4-bromo-2-chlorophenyl)ethyl]-4,4,4-trifluorobutan-1-amine |
|---|---|
| PubChem CID | 82774647 |
| Molecular Formula | C12H14BrClF3N |
| Molecular Weight | 344.60 g/mol |
| Exact Mass | 343.00 |
| IUPAC Name | N-[1-(4-bromo-2-chlorophenyl)ethyl]-4,4,4-trifluorobutan-1-amine |
| SMILES | CC(NCCCC(F)(F)F)c1ccc(Br)cc1Cl |
| InChI | InChI=1S/C12H14BrClF3N/c1-8(18-6-2-5-12(15,16)17)10-4-3-9(13)7-11(10)14/h3-4,7-8,18H,2,5-6H2,1H3 |
| InChIKey | PUPPFMUDZJZLKS-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.60 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|