C10H12Cl2F3NS — CID 103787665
N-[1-(2,5-dichlorothiophen-3-yl)ethyl]-4,4,4-trifluorobutan-1-amine (PubChem CID 103787665) has the molecular formula C10H12Cl2F3NS and a molecular weight of 306.18 g/mol. Its IUPAC name is N-[1-(2,5-dichlorothiophen-3-yl)ethyl]-4,4,4-trifluorobutan-1-amine.
| Compound Name | N-[1-(2,5-dichlorothiophen-3-yl)ethyl]-4,4,4-trifluorobutan-1-amine |
|---|---|
| PubChem CID | 103787665 |
| Molecular Formula | C10H12Cl2F3NS |
| Molecular Weight | 306.18 g/mol |
| Exact Mass | 305.00 |
| IUPAC Name | N-[1-(2,5-dichlorothiophen-3-yl)ethyl]-4,4,4-trifluorobutan-1-amine |
| SMILES | CC(NCCCC(F)(F)F)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C10H12Cl2F3NS/c1-6(7-5-8(11)17-9(7)12)16-4-2-3-10(13,14)15/h5-6,16H,2-4H2,1H3 |
| InChIKey | NMKUTWWSLGUIJK-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.18 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|