C13H20Cl2N2OS — CID 103775397
N-[1-(2,5-dichlorothiophen-3-yl)ethyl]-3-morpholin-4-ylpropan-1-amine (PubChem CID 103775397) has the molecular formula C13H20Cl2N2OS and a molecular weight of 323.29 g/mol. Its IUPAC name is N-[1-(2,5-dichlorothiophen-3-yl)ethyl]-3-morpholin-4-ylpropan-1-amine.
| Compound Name | N-[1-(2,5-dichlorothiophen-3-yl)ethyl]-3-morpholin-4-ylpropan-1-amine |
|---|---|
| PubChem CID | 103775397 |
| Molecular Formula | C13H20Cl2N2OS |
| Molecular Weight | 323.29 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | N-[1-(2,5-dichlorothiophen-3-yl)ethyl]-3-morpholin-4-ylpropan-1-amine |
| SMILES | CC(NCCCN1CCOCC1)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C13H20Cl2N2OS/c1-10(11-9-12(14)19-13(11)15)16-3-2-4-17-5-7-18-8-6-17/h9-10,16H,2-8H2,1H3 |
| InChIKey | KWADTLZCKACCPJ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.29 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|