C9H13Cl2NS — CID 43497740
N-[1-(2,5-dichlorothiophen-3-yl)ethyl]propan-1-amine (PubChem CID 43497740) has the molecular formula C9H13Cl2NS and a molecular weight of 238.18 g/mol. Its IUPAC name is N-[1-(2,5-dichlorothiophen-3-yl)ethyl]propan-1-amine.
| Compound Name | N-[1-(2,5-dichlorothiophen-3-yl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 43497740 |
| Molecular Formula | C9H13Cl2NS |
| Molecular Weight | 238.18 g/mol |
| Exact Mass | 237.01 |
| IUPAC Name | N-[1-(2,5-dichlorothiophen-3-yl)ethyl]propan-1-amine |
| SMILES | CCCNC(C)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C9H13Cl2NS/c1-3-4-12-6(2)7-5-8(10)13-9(7)11/h5-6,12H,3-4H2,1-2H3 |
| InChIKey | DCTZXYJSIUHADY-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.18 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |