C10H15Cl2NOS — CID 115709946
1-(2,5-dichlorothiophen-3-yl)-N-(2-ethoxyethyl)ethanamine (PubChem CID 115709946) has the molecular formula C10H15Cl2NOS and a molecular weight of 268.21 g/mol. Its IUPAC name is 1-(2,5-dichlorothiophen-3-yl)-N-(2-ethoxyethyl)ethanamine.
| Compound Name | 1-(2,5-dichlorothiophen-3-yl)-N-(2-ethoxyethyl)ethanamine |
|---|---|
| PubChem CID | 115709946 |
| Molecular Formula | C10H15Cl2NOS |
| Molecular Weight | 268.21 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | 1-(2,5-dichlorothiophen-3-yl)-N-(2-ethoxyethyl)ethanamine |
| SMILES | CCOCCNC(C)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C10H15Cl2NOS/c1-3-14-5-4-13-7(2)8-6-9(11)15-10(8)12/h6-7,13H,3-5H2,1-2H3 |
| InChIKey | ZFSCFRODZBRKLF-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.21 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|