C8H11Cl2NS — CID 43493044
1-(2,5-dichlorothiophen-3-yl)-N-ethylethanamine (PubChem CID 43493044) has the molecular formula C8H11Cl2NS and a molecular weight of 224.16 g/mol. Its IUPAC name is 1-(2,5-dichlorothiophen-3-yl)-N-ethylethanamine.
| Compound Name | 1-(2,5-dichlorothiophen-3-yl)-N-ethylethanamine |
|---|---|
| PubChem CID | 43493044 |
| Molecular Formula | C8H11Cl2NS |
| Molecular Weight | 224.16 g/mol |
| Exact Mass | 223.00 |
| IUPAC Name | 1-(2,5-dichlorothiophen-3-yl)-N-ethylethanamine |
| SMILES | CCNC(C)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C8H11Cl2NS/c1-3-11-5(2)6-4-7(9)12-8(6)10/h4-5,11H,3H2,1-2H3 |
| InChIKey | MKYXSRVARNSYBE-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.16 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |