C12H19Cl2NS — CID 43497732
1-(2,5-dichlorothiophen-3-yl)-N-propylpentan-1-amine (PubChem CID 43497732) has the molecular formula C12H19Cl2NS and a molecular weight of 280.26 g/mol. Its IUPAC name is 1-(2,5-dichlorothiophen-3-yl)-N-propylpentan-1-amine.
| Compound Name | 1-(2,5-dichlorothiophen-3-yl)-N-propylpentan-1-amine |
|---|---|
| PubChem CID | 43497732 |
| Molecular Formula | C12H19Cl2NS |
| Molecular Weight | 280.26 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | 1-(2,5-dichlorothiophen-3-yl)-N-propylpentan-1-amine |
| SMILES | CCCCC(NCCC)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C12H19Cl2NS/c1-3-5-6-10(15-7-4-2)9-8-11(13)16-12(9)14/h8,10,15H,3-7H2,1-2H3 |
| InChIKey | ZIHCBDIWTVIMTC-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.26 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |