C11H15Cl2NS — CID 107968368
1-(2,5-dichlorothiophen-3-yl)-N-ethylpent-4-en-1-amine (PubChem CID 107968368) has the molecular formula C11H15Cl2NS and a molecular weight of 264.22 g/mol. Its IUPAC name is 1-(2,5-dichlorothiophen-3-yl)-N-ethylpent-4-en-1-amine.
| Compound Name | 1-(2,5-dichlorothiophen-3-yl)-N-ethylpent-4-en-1-amine |
|---|---|
| PubChem CID | 107968368 |
| Molecular Formula | C11H15Cl2NS |
| Molecular Weight | 264.22 g/mol |
| Exact Mass | 263.03 |
| IUPAC Name | 1-(2,5-dichlorothiophen-3-yl)-N-ethylpent-4-en-1-amine |
| SMILES | C=CCCC(NCC)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C11H15Cl2NS/c1-3-5-6-9(14-4-2)8-7-10(12)15-11(8)13/h3,7,9,14H,1,4-6H2,2H3 |
| InChIKey | YZENTGASRAKWJU-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.22 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|