C13H19Cl2NOS — CID 107968196
1-(2,5-dichlorothiophen-3-yl)-N-ethyl-2-(oxan-4-yl)ethanamine (PubChem CID 107968196) has the molecular formula C13H19Cl2NOS and a molecular weight of 308.27 g/mol. Its IUPAC name is 1-(2,5-dichlorothiophen-3-yl)-N-ethyl-2-(oxan-4-yl)ethanamine.
| Compound Name | 1-(2,5-dichlorothiophen-3-yl)-N-ethyl-2-(oxan-4-yl)ethanamine |
|---|---|
| PubChem CID | 107968196 |
| Molecular Formula | C13H19Cl2NOS |
| Molecular Weight | 308.27 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | 1-(2,5-dichlorothiophen-3-yl)-N-ethyl-2-(oxan-4-yl)ethanamine |
| SMILES | CCNC(CC1CCOCC1)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C13H19Cl2NOS/c1-2-16-11(7-9-3-5-17-6-4-9)10-8-12(14)18-13(10)15/h8-9,11,16H,2-7H2,1H3 |
| InChIKey | PTAMQVAERMRJHS-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.27 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |