C11H16Cl2N2OS — CID 107970203
[1-(2,5-dichlorothiophen-3-yl)-2-(oxan-4-yl)ethyl]hydrazine (PubChem CID 107970203) has the molecular formula C11H16Cl2N2OS and a molecular weight of 295.24 g/mol. Its IUPAC name is [1-(2,5-dichlorothiophen-3-yl)-2-(oxan-4-yl)ethyl]hydrazine.
| Compound Name | [1-(2,5-dichlorothiophen-3-yl)-2-(oxan-4-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 107970203 |
| Molecular Formula | C11H16Cl2N2OS |
| Molecular Weight | 295.24 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | [1-(2,5-dichlorothiophen-3-yl)-2-(oxan-4-yl)ethyl]hydrazine |
| SMILES | NNC(CC1CCOCC1)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C11H16Cl2N2OS/c12-10-6-8(11(13)17-10)9(15-14)5-7-1-3-16-4-2-7/h6-7,9,15H,1-5,14H2 |
| InChIKey | NCYAXRXJXQZPPA-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.24 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|