C10H14Cl2N2S — CID 107970378
[3-cyclopropyl-1-(2,5-dichlorothiophen-3-yl)propyl]hydrazine (PubChem CID 107970378) has the molecular formula C10H14Cl2N2S and a molecular weight of 265.21 g/mol. Its IUPAC name is [3-cyclopropyl-1-(2,5-dichlorothiophen-3-yl)propyl]hydrazine.
| Compound Name | [3-cyclopropyl-1-(2,5-dichlorothiophen-3-yl)propyl]hydrazine |
|---|---|
| PubChem CID | 107970378 |
| Molecular Formula | C10H14Cl2N2S |
| Molecular Weight | 265.21 g/mol |
| Exact Mass | 264.03 |
| IUPAC Name | [3-cyclopropyl-1-(2,5-dichlorothiophen-3-yl)propyl]hydrazine |
| SMILES | NNC(CCC1CC1)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C10H14Cl2N2S/c11-9-5-7(10(12)15-9)8(14-13)4-3-6-1-2-6/h5-6,8,14H,1-4,13H2 |
| InChIKey | DFEQILJZBJGCDZ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.21 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|