C14H14Cl2N2S — CID 114022357
[2-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)-1-(2,5-dichlorothiophen-3-yl)ethyl]hydrazine (PubChem CID 114022357) has the molecular formula C14H14Cl2N2S and a molecular weight of 313.25 g/mol. Its IUPAC name is [2-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)-1-(2,5-dichlorothiophen-3-yl)ethyl]hydrazine.
| Compound Name | [2-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)-1-(2,5-dichlorothiophen-3-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 114022357 |
| Molecular Formula | C14H14Cl2N2S |
| Molecular Weight | 313.25 g/mol |
| Exact Mass | 312.03 |
| IUPAC Name | [2-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)-1-(2,5-dichlorothiophen-3-yl)ethyl]hydrazine |
| SMILES | NNC(CC1Cc2ccccc21)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C14H14Cl2N2S/c15-13-7-11(14(16)19-13)12(18-17)6-9-5-8-3-1-2-4-10(8)9/h1-4,7,9,12,18H,5-6,17H2 |
| InChIKey | LONDBUJYNVGPIA-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.25 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|