C17H18N4 — CID 103129783
[2-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)-1-pyrazolo[1,5-a]pyridin-3-ylethyl]hydrazine (PubChem CID 103129783) has the molecular formula C17H18N4 and a molecular weight of 278.36 g/mol. Its IUPAC name is [2-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)-1-pyrazolo[1,5-a]pyridin-3-ylethyl]hydrazine.
| Compound Name | [2-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)-1-pyrazolo[1,5-a]pyridin-3-ylethyl]hydrazine |
|---|---|
| PubChem CID | 103129783 |
| Molecular Formula | C17H18N4 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | [2-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)-1-pyrazolo[1,5-a]pyridin-3-ylethyl]hydrazine |
| SMILES | NNC(CC1Cc2ccccc21)c1cnn2ccccc12 |
| InChI | InChI=1S/C17H18N4/c18-20-16(10-13-9-12-5-1-2-6-14(12)13)15-11-19-21-8-4-3-7-17(15)21/h1-8,11,13,16,20H,9-10,18H2 |
| InChIKey | LBYJREDZIUCNBV-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 55.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|