C13H20N4 — CID 103129533
1-pyrazolo[1,5-a]pyridin-3-ylhexylhydrazine (PubChem CID 103129533) has the molecular formula C13H20N4 and a molecular weight of 232.33 g/mol. Its IUPAC name is 1-pyrazolo[1,5-a]pyridin-3-ylhexylhydrazine.
| Compound Name | 1-pyrazolo[1,5-a]pyridin-3-ylhexylhydrazine |
|---|---|
| PubChem CID | 103129533 |
| Molecular Formula | C13H20N4 |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.17 |
| IUPAC Name | 1-pyrazolo[1,5-a]pyridin-3-ylhexylhydrazine |
| SMILES | CCCCCC(NN)c1cnn2ccccc12 |
| InChI | InChI=1S/C13H20N4/c1-2-3-4-7-12(16-14)11-10-15-17-9-6-5-8-13(11)17/h5-6,8-10,12,16H,2-4,7,14H2,1H3 |
| InChIKey | FVGVVSHVOSMDCY-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 55.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|