C18H28N2 — CID 170095854
3-undecan-5-ylpyrazolo[1,5-a]pyridine (PubChem CID 170095854) has the molecular formula C18H28N2 and a molecular weight of 272.44 g/mol. Its IUPAC name is 3-undecan-5-ylpyrazolo[1,5-a]pyridine.
| Compound Name | 3-undecan-5-ylpyrazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 170095854 |
| Molecular Formula | C18H28N2 |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.23 |
| IUPAC Name | 3-undecan-5-ylpyrazolo[1,5-a]pyridine |
| SMILES | CCCCCCC(CCCC)c1cnn2ccccc12 |
| InChI | InChI=1S/C18H28N2/c1-3-5-7-8-12-16(11-6-4-2)17-15-19-20-14-10-9-13-18(17)20/h9-10,13-16H,3-8,11-12H2,1-2H3 |
| InChIKey | GQYFOIYQCTVWCF-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|