About formaldehyde;2-tridecan-5-ylphenol
formaldehyde;2-tridecan-5-ylphenol (PubChem CID 130205554) has the molecular formula C20H34O2
and a molecular weight of 306.49 g/mol. Its IUPAC name is formaldehyde;2-tridecan-5-ylphenol.
Molecular Properties
| Compound Name | formaldehyde;2-tridecan-5-ylphenol |
| PubChem CID | 130205554 |
| Molecular Formula | C20H34O2 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.26 |
| IUPAC Name | formaldehyde;2-tridecan-5-ylphenol |
| SMILES | C=O.CCCCCCCCC(CCCC)c1ccccc1O |
| InChI | InChI=1S/C19H32O.CH2O/c1-3-5-7-8-9-10-14-17(13-6-4-2)18-15-11-12-16-19(18)20;1-2/h11-12,15-17,20H,3-10,13-14H2,1-2H3;1H2 |
| InChIKey | HCNUIHBYRUNRQY-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze formaldehyde;2-tridecan-5-ylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formaldehyde;2-tridecan-5-ylphenol?
The IUPAC name of formaldehyde;2-tridecan-5-ylphenol (CID 130205554) is formaldehyde;2-tridecan-5-ylphenol.
What is the SMILES notation for formaldehyde;2-tridecan-5-ylphenol?
The canonical SMILES for formaldehyde;2-tridecan-5-ylphenol is C=O.CCCCCCCCC(CCCC)c1ccccc1O.
What is the InChIKey of formaldehyde;2-tridecan-5-ylphenol?
The InChIKey is HCNUIHBYRUNRQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H32O.CH2O/c1-3-5-7-8-9-10-14-17(13-6-4-2)18-15-11-12-16-19(18)20;1-2/h11-12,15-17,20H,3-10,13-14H2,1-2H3;1H2.
What are the key properties of formaldehyde;2-tridecan-5-ylphenol?
formaldehyde;2-tridecan-5-ylphenol has a molecular weight of 306.49 g/mol, XLogP of 6.23, 11 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for formaldehyde;2-tridecan-5-ylphenol is sourced from PubChem (CID 130205554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).