About 2-pentadecan-6-ylphenol
2-pentadecan-6-ylphenol (PubChem CID 66865451) has the molecular formula C21H36O
and a molecular weight of 304.52 g/mol. Its IUPAC name is 2-pentadecan-6-ylphenol.
Molecular Properties
| Compound Name | 2-pentadecan-6-ylphenol |
| PubChem CID | 66865451 |
| Molecular Formula | C21H36O |
| Molecular Weight | 304.52 g/mol |
| Exact Mass | 304.28 |
| IUPAC Name | 2-pentadecan-6-ylphenol |
| SMILES | CCCCCCCCCC(CCCCC)c1ccccc1O |
| InChI | InChI=1S/C21H36O/c1-3-5-7-8-9-10-12-16-19(15-11-6-4-2)20-17-13-14-18-21(20)22/h13-14,17-19,22H,3-12,15-16H2,1-2H3 |
| InChIKey | XHDVSVOGIVXODW-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 304.52 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-pentadecan-6-ylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pentadecan-6-ylphenol?
The IUPAC name of 2-pentadecan-6-ylphenol (CID 66865451) is 2-pentadecan-6-ylphenol.
What is the SMILES notation for 2-pentadecan-6-ylphenol?
The canonical SMILES for 2-pentadecan-6-ylphenol is CCCCCCCCCC(CCCCC)c1ccccc1O.
What is the InChIKey of 2-pentadecan-6-ylphenol?
The InChIKey is XHDVSVOGIVXODW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H36O/c1-3-5-7-8-9-10-12-16-19(15-11-6-4-2)20-17-13-14-18-21(20)22/h13-14,17-19,22H,3-12,15-16H2,1-2H3.
What are the key properties of 2-pentadecan-6-ylphenol?
2-pentadecan-6-ylphenol has a molecular weight of 304.52 g/mol, XLogP of 7.20, 13 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pentadecan-6-ylphenol is sourced from PubChem (CID 66865451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).