About 2-(1-phenylnonyl)phenol
2-(1-phenylnonyl)phenol (PubChem CID 67177643) has the molecular formula C21H28O
and a molecular weight of 296.45 g/mol. Its IUPAC name is 2-(1-phenylnonyl)phenol.
Molecular Properties
| Compound Name | 2-(1-phenylnonyl)phenol |
| PubChem CID | 67177643 |
| Molecular Formula | C21H28O |
| Molecular Weight | 296.45 g/mol |
| Exact Mass | 296.21 |
| IUPAC Name | 2-(1-phenylnonyl)phenol |
| SMILES | CCCCCCCCC(c1ccccc1)c1ccccc1O |
| InChI | InChI=1S/C21H28O/c1-2-3-4-5-6-10-15-19(18-13-8-7-9-14-18)20-16-11-12-17-21(20)22/h7-9,11-14,16-17,19,22H,2-6,10,15H2,1H3 |
| InChIKey | PONXCWMFULIXIZ-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 296.45 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-phenylnonyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-phenylnonyl)phenol?
The IUPAC name of 2-(1-phenylnonyl)phenol (CID 67177643) is 2-(1-phenylnonyl)phenol.
What is the SMILES notation for 2-(1-phenylnonyl)phenol?
The canonical SMILES for 2-(1-phenylnonyl)phenol is CCCCCCCCC(c1ccccc1)c1ccccc1O.
What is the InChIKey of 2-(1-phenylnonyl)phenol?
The InChIKey is PONXCWMFULIXIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H28O/c1-2-3-4-5-6-10-15-19(18-13-8-7-9-14-18)20-16-11-12-17-21(20)22/h7-9,11-14,16-17,19,22H,2-6,10,15H2,1H3.
What are the key properties of 2-(1-phenylnonyl)phenol?
2-(1-phenylnonyl)phenol has a molecular weight of 296.45 g/mol, XLogP of 6.27, 9 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-phenylnonyl)phenol is sourced from PubChem (CID 67177643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).